C33H33NO7 — CID 7853179
2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7853179) has the molecular formula C33H33NO7 and a molecular weight of 555.63 g/mol. Its IUPAC name is 2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7853179 |
| Molecular Formula | C33H33NO7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)N=C(C)C(C(=O)OCCOc2ccccc2)[C@@H]3c2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C33H33NO7/c1-20-30(33(37)41-16-15-40-25-7-5-4-6-8-25)31(21-9-12-24(35)13-10-21)32-26(34-20)17-23(18-27(32)36)22-11-14-28(38-2)29(19-22)39-3/h4-14,19,23,30-31,35H,15-18H2,1-3H3/t23-,30?,31-/m0/s1 |
| InChIKey | GVMJMKUSCDNUHL-SKXYDITNSA-N |
| XLogP | 5.61 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|