C40H39NO6 — CID 7853203
2-phenylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7853203) has the molecular formula C40H39NO6 and a molecular weight of 629.75 g/mol. Its IUPAC name is 2-phenylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-phenylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7853203 |
| Molecular Formula | C40H39NO6 |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | 2-phenylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)N=C(C)C(C(=O)OCCc2ccccc2)[C@@H]3c2cccc(OCc3ccccc3)c2)cc1OC |
| InChI | InChI=1S/C40H39NO6/c1-26-37(40(43)46-20-19-27-11-6-4-7-12-27)38(30-15-10-16-32(21-30)47-25-28-13-8-5-9-14-28)39-33(41-26)22-31(23-34(39)42)29-17-18-35(44-2)36(24-29)45-3/h4-18,21,24,31,37-38H,19-20,22-23,25H2,1-3H3/t31-,37?,38-/m0/s1 |
| InChIKey | DWIZUKCDXMBNBA-GHUCLESWSA-N |
| XLogP | 7.64 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |