C33H32FNO5 — CID 7894725
2-phenylethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7894725) has the molecular formula C33H32FNO5 and a molecular weight of 541.62 g/mol. Its IUPAC name is 2-phenylethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-phenylethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7894725 |
| Molecular Formula | C33H32FNO5 |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 2-phenylethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-fluorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)N=C(C)C(C(=O)OCCc2ccccc2)[C@@H]3c2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C33H32FNO5/c1-20-30(33(37)40-15-14-21-8-5-4-6-9-21)31(23-10-7-11-25(34)16-23)32-26(35-20)17-24(18-27(32)36)22-12-13-28(38-2)29(19-22)39-3/h4-13,16,19,24,30-31H,14-15,17-18H2,1-3H3/t24-,30?,31+/m1/s1 |
| InChIKey | IAXCJMUVNNPMLC-IYAVVDSWSA-N |
| XLogP | 6.20 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |