C33H33NO6 — CID 7853199
methyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7853199) has the molecular formula C33H33NO6 and a molecular weight of 539.63 g/mol. Its IUPAC name is methyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | methyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7853199 |
| Molecular Formula | C33H33NO6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | methyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1C(C)=NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H33NO6/c1-20-30(33(36)39-4)31(23-11-8-12-25(15-23)40-19-21-9-6-5-7-10-21)32-26(34-20)16-24(17-27(32)35)22-13-14-28(37-2)29(18-22)38-3/h5-15,18,24,30-31H,16-17,19H2,1-4H3/t24-,30?,31-/m0/s1 |
| InChIKey | KWHVKWHWOJEMAF-MLOHWOOJSA-N |
| XLogP | 6.03 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |