C34H35NO6 — CID 7909723
ethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7909723) has the molecular formula C34H35NO6 and a molecular weight of 553.66 g/mol. Its IUPAC name is ethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | ethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7909723 |
| Molecular Formula | C34H35NO6 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | ethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C(C)=NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C34H35NO6/c1-5-40-34(37)31-21(2)35-27-17-25(23-14-15-29(38-3)30(19-23)39-4)18-28(36)33(27)32(31)24-12-9-13-26(16-24)41-20-22-10-7-6-8-11-22/h6-16,19,25,31-32H,5,17-18,20H2,1-4H3/t25-,31?,32+/m0/s1 |
| InChIKey | COZABNDAANDHTA-LOKXLOOWSA-N |
| XLogP | 6.42 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |