C36H39NO6 — CID 7910228
[(2R)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7910228) has the molecular formula C36H39NO6 and a molecular weight of 581.71 g/mol. Its IUPAC name is [(2R)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | [(2R)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7910228 |
| Molecular Formula | C36H39NO6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | [(2R)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CC[C@@H](C)OC(=O)C1C(C)=NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C36H39NO6/c1-6-22(2)43-36(39)33-23(3)37-29-18-27(25-15-16-31(40-4)32(20-25)41-5)19-30(38)35(29)34(33)26-13-10-14-28(17-26)42-21-24-11-8-7-9-12-24/h7-17,20,22,27,33-34H,6,18-19,21H2,1-5H3/t22-,27-,33?,34-/m1/s1 |
| InChIKey | LBLWRPJSCBCUJE-AAVYDUAHSA-N |
| XLogP | 7.20 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |