C37H39NO6 — CID 7853220
cyclopentyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7853220) has the molecular formula C37H39NO6 and a molecular weight of 593.72 g/mol. Its IUPAC name is cyclopentyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | cyclopentyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7853220 |
| Molecular Formula | C37H39NO6 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | cyclopentyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)N=C(C)C(C(=O)OC2CCCC2)[C@@H]3c2ccccc2OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C37H39NO6/c1-23-34(37(40)44-27-13-7-8-14-27)35(28-15-9-10-16-31(28)43-22-24-11-5-4-6-12-24)36-29(38-23)19-26(20-30(36)39)25-17-18-32(41-2)33(21-25)42-3/h4-6,9-12,15-18,21,26-27,34-35H,7-8,13-14,19-20,22H2,1-3H3/t26-,34?,35-/m0/s1 |
| InChIKey | AOWWJPCIMIYMOB-PCZBHSGESA-N |
| XLogP | 7.34 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |