C25H33NO5 — CID 2847969
2-ethoxyethyl 4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 2847969) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is 2-ethoxyethyl 4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-ethoxyethyl 4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 2847969 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 2-ethoxyethyl 4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCCCOc1ccccc1C1C(C(=O)OCCOCC)=C(C)NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C25H33NO5/c1-4-6-14-30-21-13-8-7-10-18(21)23-22(25(28)31-16-15-29-5-2)17(3)26-19-11-9-12-20(27)24(19)23/h7-8,10,13,23,26H,4-6,9,11-12,14-16H2,1-3H3 |
| InChIKey | GUZIIJSIPWNWEN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|