C27H35NO4 — CID 2847642
cyclohexyl 4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 2847642) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is cyclohexyl 4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclohexyl 4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 2847642 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | cyclohexyl 4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCCCOc1ccccc1C1C(C(=O)OC2CCCCC2)=C(C)NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C27H35NO4/c1-3-4-17-31-23-16-9-8-13-20(23)25-24(27(30)32-19-11-6-5-7-12-19)18(2)28-21-14-10-15-22(29)26(21)25/h8-9,13,16,19,25,28H,3-7,10-12,14-15,17H2,1-2H3 |
| InChIKey | INFUVSOZCYBBND-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|