C23H26INO3 — CID 1083442
cyclohexyl (4R)-4-(2-iodophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1083442) has the molecular formula C23H26INO3 and a molecular weight of 491.37 g/mol. Its IUPAC name is cyclohexyl (4R)-4-(2-iodophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclohexyl (4R)-4-(2-iodophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1083442 |
| Molecular Formula | C23H26INO3 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | cyclohexyl (4R)-4-(2-iodophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCC2)[C@H](c2ccccc2I)C2=C(CCCC2=O)N1 |
| InChI | InChI=1S/C23H26INO3/c1-14-20(23(27)28-15-8-3-2-4-9-15)21(16-10-5-6-11-17(16)24)22-18(25-14)12-7-13-19(22)26/h5-6,10-11,15,21,25H,2-4,7-9,12-13H2,1H3/t21-/m0/s1 |
| InChIKey | PFIDWIAUTLSSHF-NRFANRHFSA-N |
| XLogP | 5.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|