C21H24ClNO3 — CID 2848281
butyl 4-(2-chlorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 2848281) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is butyl 4-(2-chlorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | butyl 4-(2-chlorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 2848281 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | butyl 4-(2-chlorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)NC2=C(C(=O)CCC2)C1c1ccccc1Cl |
| InChI | InChI=1S/C21H24ClNO3/c1-3-4-12-26-21(25)18-13(2)23-16-10-7-11-17(24)20(16)19(18)14-8-5-6-9-15(14)22/h5-6,8-9,19,23H,3-4,7,10-12H2,1-2H3 |
| InChIKey | COHNVGGRUGXQGK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|