C21H22N2O4 — CID 126228400
2-[2-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)phenoxy]acetamide (PubChem CID 126228400) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[2-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)phenoxy]acetamide.
| Compound Name | 2-[2-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126228400 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[2-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)phenoxy]acetamide |
| SMILES | NC(=O)COc1ccccc1C1C2=C(CCCC2=O)NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C21H22N2O4/c22-18(26)11-27-17-10-2-1-5-12(17)19-20-13(6-3-8-15(20)24)23-14-7-4-9-16(25)21(14)19/h1-2,5,10,19,23H,3-4,6-9,11H2,(H2,22,26) |
| InChIKey | BBFGEOLKBJVWGK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |