C52H48O6 — CID 158738327
ethyl 4-[2-(2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoate;4-[2-(2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoic acid (PubChem CID 158738327) has the molecular formula C52H48O6 and a molecular weight of 768.95 g/mol. Its IUPAC name is ethyl 4-[2-(2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoate;4-[2-(2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoic acid.
| Compound Name | ethyl 4-[2-(2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoate;4-[2-(2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoic acid |
|---|---|
| PubChem CID | 158738327 |
| Molecular Formula | C52H48O6 |
| Molecular Weight | 768.95 g/mol |
| Exact Mass | 768.35 |
| IUPAC Name | ethyl 4-[2-(2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoate;4-[2-(2-phenylmethoxyphenyl)cyclopenten-1-yl]benzoic acid |
| SMILES | CCOC(=O)c1ccc(C2=C(c3ccccc3OCc3ccccc3)CCC2)cc1.O=C(O)c1ccc(C2=C(c3ccccc3OCc3ccccc3)CCC2)cc1 |
| InChI | InChI=1S/C27H26O3.C25H22O3/c1-2-29-27(28)22-17-15-21(16-18-22)23-12-8-13-24(23)25-11-6-7-14-26(25)30-19-20-9-4-3-5-10-20;26-25(27)20-15-13-19(14-16-20)21-10-6-11-22(21)23-9-4-5-12-24(23)28-17-18-7-2-1-3-8-18/h3-7,9-11,14-18H,2,8,12-13,19H2,1H3;1-5,7-9,12-16H,6,10-11,17H2,(H,26,27) |
| InChIKey | ILYVIOQWFQUNFE-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.95 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|