C26H23BrO3 — CID 91053902
3-[2-(5-bromo-2-phenylmethoxyphenyl)cyclopenten-1-yl]-5-methylbenzoic acid (PubChem CID 91053902) has the molecular formula C26H23BrO3 and a molecular weight of 463.37 g/mol. Its IUPAC name is 3-[2-(5-bromo-2-phenylmethoxyphenyl)cyclopenten-1-yl]-5-methylbenzoic acid.
| Compound Name | 3-[2-(5-bromo-2-phenylmethoxyphenyl)cyclopenten-1-yl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 91053902 |
| Molecular Formula | C26H23BrO3 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 3-[2-(5-bromo-2-phenylmethoxyphenyl)cyclopenten-1-yl]-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(C2=C(c3cc(Br)ccc3OCc3ccccc3)CCC2)c1 |
| InChI | InChI=1S/C26H23BrO3/c1-17-12-19(14-20(13-17)26(28)29)22-8-5-9-23(22)24-15-21(27)10-11-25(24)30-16-18-6-3-2-4-7-18/h2-4,6-7,10-15H,5,8-9,16H2,1H3,(H,28,29) |
| InChIKey | HFGUHNWUAPLQCK-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|