C27H24F3NO4S — CID 142815813
3-(methanesulfinamido)-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoic acid (PubChem CID 142815813) has the molecular formula C27H24F3NO4S and a molecular weight of 515.55 g/mol. Its IUPAC name is 3-(methanesulfinamido)-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoic acid.
| Compound Name | 3-(methanesulfinamido)-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoic acid |
|---|---|
| PubChem CID | 142815813 |
| Molecular Formula | C27H24F3NO4S |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 3-(methanesulfinamido)-5-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoic acid |
| SMILES | CS(=O)Nc1cc(C(=O)O)cc(C2=C(c3cc(C(F)(F)F)ccc3OCc3ccccc3)CCC2)c1 |
| InChI | InChI=1S/C27H24F3NO4S/c1-36(34)31-21-13-18(12-19(14-21)26(32)33)22-8-5-9-23(22)24-15-20(27(28,29)30)10-11-25(24)35-16-17-6-3-2-4-7-17/h2-4,6-7,10-15,31H,5,8-9,16H2,1H3,(H,32,33) |
| InChIKey | YGLWOIQNXVLMMW-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|