C25H22F3NO — CID 141079399
4-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]aniline (PubChem CID 141079399) has the molecular formula C25H22F3NO and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]aniline.
| Compound Name | 4-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]aniline |
|---|---|
| PubChem CID | 141079399 |
| Molecular Formula | C25H22F3NO |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 4-[2-[2-phenylmethoxy-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]aniline |
| SMILES | Nc1ccc(C2=C(c3cc(C(F)(F)F)ccc3OCc3ccccc3)CCC2)cc1 |
| InChI | InChI=1S/C25H22F3NO/c26-25(27,28)19-11-14-24(30-16-17-5-2-1-3-6-17)23(15-19)22-8-4-7-21(22)18-9-12-20(29)13-10-18/h1-3,5-6,9-15H,4,7-8,16,29H2 |
| InChIKey | DWNPIRINVUACFT-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|