C25H20ClFO3 — CID 21112963
5-[2-(5-chloro-2-phenylmethoxyphenyl)cyclopenten-1-yl]-2-fluorobenzoic acid (PubChem CID 21112963) has the molecular formula C25H20ClFO3 and a molecular weight of 422.88 g/mol. Its IUPAC name is 5-[2-(5-chloro-2-phenylmethoxyphenyl)cyclopenten-1-yl]-2-fluorobenzoic acid.
| Compound Name | 5-[2-(5-chloro-2-phenylmethoxyphenyl)cyclopenten-1-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 21112963 |
| Molecular Formula | C25H20ClFO3 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 5-[2-(5-chloro-2-phenylmethoxyphenyl)cyclopenten-1-yl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(C2=C(c3cc(Cl)ccc3OCc3ccccc3)CCC2)ccc1F |
| InChI | InChI=1S/C25H20ClFO3/c26-18-10-12-24(30-15-16-5-2-1-3-6-16)21(14-18)20-8-4-7-19(20)17-9-11-23(27)22(13-17)25(28)29/h1-3,5-6,9-14H,4,7-8,15H2,(H,28,29) |
| InChIKey | QEFJDEWLIJJCER-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|