C20H13F3O3 — CID 172650688
2-phenylmethoxy-5-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 172650688) has the molecular formula C20H13F3O3 and a molecular weight of 358.32 g/mol. Its IUPAC name is 2-phenylmethoxy-5-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 2-phenylmethoxy-5-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 172650688 |
| Molecular Formula | C20H13F3O3 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-phenylmethoxy-5-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2cc(F)c(F)c(F)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H13F3O3/c21-16-9-14(10-17(22)19(16)23)13-6-7-18(15(8-13)20(24)25)26-11-12-4-2-1-3-5-12/h1-10H,11H2,(H,24,25) |
| InChIKey | LNTYOKSDJNMZPL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|