C44H37F2NO4 — CID 159263392
4-(3,5-dimethyl-4-phenylmethoxyphenyl)-2-fluorobenzoic acid;5-(3-fluoro-4-isocyanophenyl)-1,3-dimethyl-2-phenylmethoxybenzene (PubChem CID 159263392) has the molecular formula C44H37F2NO4 and a molecular weight of 681.78 g/mol. Its IUPAC name is 4-(3,5-dimethyl-4-phenylmethoxyphenyl)-2-fluorobenzoic acid;5-(3-fluoro-4-isocyanophenyl)-1,3-dimethyl-2-phenylmethoxybenzene.
| Compound Name | 4-(3,5-dimethyl-4-phenylmethoxyphenyl)-2-fluorobenzoic acid;5-(3-fluoro-4-isocyanophenyl)-1,3-dimethyl-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 159263392 |
| Molecular Formula | C44H37F2NO4 |
| Molecular Weight | 681.78 g/mol |
| Exact Mass | 681.27 |
| IUPAC Name | 4-(3,5-dimethyl-4-phenylmethoxyphenyl)-2-fluorobenzoic acid;5-(3-fluoro-4-isocyanophenyl)-1,3-dimethyl-2-phenylmethoxybenzene |
| SMILES | Cc1cc(-c2ccc(C(=O)O)c(F)c2)cc(C)c1OCc1ccccc1.[C-]#[N+]c1ccc(-c2cc(C)c(OCc3ccccc3)c(C)c2)cc1F |
| InChI | InChI=1S/C22H18FNO.C22H19FO3/c1-15-11-19(18-9-10-21(24-3)20(23)13-18)12-16(2)22(15)25-14-17-7-5-4-6-8-17;1-14-10-18(17-8-9-19(22(24)25)20(23)12-17)11-15(2)21(14)26-13-16-6-4-3-5-7-16/h4-13H,14H2,1-2H3;3-12H,13H2,1-2H3,(H,24,25) |
| InChIKey | KWUGQNFJRFUACA-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 60.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.78 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|