C26H20FNO4 — CID 175422727
4-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-fluorobenzoic acid (PubChem CID 175422727) has the molecular formula C26H20FNO4 and a molecular weight of 429.45 g/mol. Its IUPAC name is 4-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-fluorobenzoic acid.
| Compound Name | 4-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 175422727 |
| Molecular Formula | C26H20FNO4 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 4-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)cc1F |
| InChI | InChI=1S/C26H20FNO4/c27-23-15-20(11-12-22(23)26(29)30)21-13-14-24(31-16-18-7-3-1-4-8-18)28-25(21)32-17-19-9-5-2-6-10-19/h1-15H,16-17H2,(H,29,30) |
| InChIKey | SAYXOFIZXFQHHI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |