C16H17NO5 — CID 91075341
ethane;6-phenylmethoxypyridine-2,3-dicarboxylic acid (PubChem CID 91075341) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is ethane;6-phenylmethoxypyridine-2,3-dicarboxylic acid.
| Compound Name | ethane;6-phenylmethoxypyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91075341 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | ethane;6-phenylmethoxypyridine-2,3-dicarboxylic acid |
| SMILES | CC.O=C(O)c1ccc(OCc2ccccc2)nc1C(=O)O |
| InChI | InChI=1S/C14H11NO5.C2H6/c16-13(17)10-6-7-11(15-12(10)14(18)19)20-8-9-4-2-1-3-5-9;1-2/h1-7H,8H2,(H,16,17)(H,18,19);1-2H3 |
| InChIKey | PAHPLOKYEORKJV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |