C29H24N2O4 — CID 171788735
methyl 5-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1H-indole-2-carboxylate (PubChem CID 171788735) has the molecular formula C29H24N2O4 and a molecular weight of 464.52 g/mol. Its IUPAC name is methyl 5-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1H-indole-2-carboxylate.
| Compound Name | methyl 5-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 171788735 |
| Molecular Formula | C29H24N2O4 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | methyl 5-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(-c3ccc(OCc4ccccc4)nc3OCc3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C29H24N2O4/c1-33-29(32)26-17-23-16-22(12-14-25(23)30-26)24-13-15-27(34-18-20-8-4-2-5-9-20)31-28(24)35-19-21-10-6-3-7-11-21/h2-17,30H,18-19H2,1H3 |
| InChIKey | DERKQOAYKNZZCS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |