C31H31NO5 — CID 167478711
tert-butyl 2-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenoxy]acetate (PubChem CID 167478711) has the molecular formula C31H31NO5 and a molecular weight of 497.59 g/mol. Its IUPAC name is tert-butyl 2-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenoxy]acetate |
|---|---|
| PubChem CID | 167478711 |
| Molecular Formula | C31H31NO5 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | tert-butyl 2-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1cccc(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C31H31NO5/c1-31(2,3)37-29(33)22-34-26-16-10-15-25(19-26)27-17-18-28(35-20-23-11-6-4-7-12-23)32-30(27)36-21-24-13-8-5-9-14-24/h4-19H,20-22H2,1-3H3 |
| InChIKey | MSANRYXGCLFZDJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |