C29H29N3O4 — CID 166552767
tert-butyl N-[5-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-pyridinyl]carbamate (PubChem CID 166552767) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is tert-butyl N-[5-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 166552767 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | tert-butyl N-[5-[2,6-bis(phenylmethoxy)-3-pyridinyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)cn1 |
| InChI | InChI=1S/C29H29N3O4/c1-29(2,3)36-28(33)31-25-16-14-23(18-30-25)24-15-17-26(34-19-21-10-6-4-7-11-21)32-27(24)35-20-22-12-8-5-9-13-22/h4-18H,19-20H2,1-3H3,(H,30,31,33) |
| InChIKey | GBGCJYIHSCHPEK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |