C26H22BrNO4 — CID 175548926
3-(4-bromophenyl)-2,6-bis(phenylmethoxy)pyridine;formic acid (PubChem CID 175548926) has the molecular formula C26H22BrNO4 and a molecular weight of 492.37 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2,6-bis(phenylmethoxy)pyridine;formic acid.
| Compound Name | 3-(4-bromophenyl)-2,6-bis(phenylmethoxy)pyridine;formic acid |
|---|---|
| PubChem CID | 175548926 |
| Molecular Formula | C26H22BrNO4 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 3-(4-bromophenyl)-2,6-bis(phenylmethoxy)pyridine;formic acid |
| SMILES | Brc1ccc(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)cc1.O=CO |
| InChI | InChI=1S/C25H20BrNO2.CH2O2/c26-22-13-11-21(12-14-22)23-15-16-24(28-17-19-7-3-1-4-8-19)27-25(23)29-18-20-9-5-2-6-10-20;2-1-3/h1-16H,17-18H2;1H,(H,2,3) |
| InChIKey | LCCAIWMLSCKLBJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|