C29H24N2O2 — CID 175543369
2,6-bis(phenylmethoxy)-3-(4-pyrrol-1-ylphenyl)pyridine (PubChem CID 175543369) has the molecular formula C29H24N2O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2,6-bis(phenylmethoxy)-3-(4-pyrrol-1-ylphenyl)pyridine.
| Compound Name | 2,6-bis(phenylmethoxy)-3-(4-pyrrol-1-ylphenyl)pyridine |
|---|---|
| PubChem CID | 175543369 |
| Molecular Formula | C29H24N2O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2,6-bis(phenylmethoxy)-3-(4-pyrrol-1-ylphenyl)pyridine |
| SMILES | c1ccc(COc2ccc(-c3ccc(-n4cccc4)cc3)c(OCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C29H24N2O2/c1-3-9-23(10-4-1)21-32-28-18-17-27(29(30-28)33-22-24-11-5-2-6-12-24)25-13-15-26(16-14-25)31-19-7-8-20-31/h1-20H,21-22H2 |
| InChIKey | MJFUEIWSPYDEET-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |