C30H30N2O4 — CID 176885958
[(2R)-4-[4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]morpholin-2-yl]methanol (PubChem CID 176885958) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is [(2R)-4-[4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]morpholin-2-yl]methanol.
| Compound Name | [(2R)-4-[4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 176885958 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [(2R)-4-[4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]morpholin-2-yl]methanol |
| SMILES | OC[C@H]1CN(c2ccc(-c3ccc(OCc4ccccc4)nc3OCc3ccccc3)cc2)CCO1 |
| InChI | InChI=1S/C30H30N2O4/c33-20-27-19-32(17-18-34-27)26-13-11-25(12-14-26)28-15-16-29(35-21-23-7-3-1-4-8-23)31-30(28)36-22-24-9-5-2-6-10-24/h1-16,27,33H,17-22H2/t27-/m1/s1 |
| InChIKey | ZEYDGGLIBKGEIU-HHHXNRCGSA-N |
| XLogP | 5.10 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |