C26H22ClFO3 — CID 90751599
3-[[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]methyl]benzoic acid (PubChem CID 90751599) has the molecular formula C26H22ClFO3 and a molecular weight of 436.91 g/mol. Its IUPAC name is 3-[[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 90751599 |
| Molecular Formula | C26H22ClFO3 |
| Molecular Weight | 436.91 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 3-[[2-[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]cyclopenten-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CC2=C(c3cc(Cl)ccc3OCc3ccc(F)cc3)CCC2)c1 |
| InChI | InChI=1S/C26H22ClFO3/c27-21-9-12-25(31-16-17-7-10-22(28)11-8-17)24(15-21)23-6-2-4-19(23)13-18-3-1-5-20(14-18)26(29)30/h1,3,5,7-12,14-15H,2,4,6,13,16H2,(H,29,30) |
| InChIKey | LZYDAYJJFSSJPM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.91 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |