C24H17ClN2O3 — CID 11429983
3-[3-(5-chloro-2-phenylmethoxyphenyl)pyrazin-2-yl]benzoic acid (PubChem CID 11429983) has the molecular formula C24H17ClN2O3 and a molecular weight of 416.86 g/mol. Its IUPAC name is 3-[3-(5-chloro-2-phenylmethoxyphenyl)pyrazin-2-yl]benzoic acid.
| Compound Name | 3-[3-(5-chloro-2-phenylmethoxyphenyl)pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 11429983 |
| Molecular Formula | C24H17ClN2O3 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 3-[3-(5-chloro-2-phenylmethoxyphenyl)pyrazin-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nccnc2-c2cc(Cl)ccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H17ClN2O3/c25-19-9-10-21(30-15-16-5-2-1-3-6-16)20(14-19)23-22(26-11-12-27-23)17-7-4-8-18(13-17)24(28)29/h1-14H,15H2,(H,28,29) |
| InChIKey | LEKGNTCKYBKOGI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |