C23H15ClNO3S- — CID 18718074
5-[3-(5-chloro-2-phenylmethoxyphenyl)thiophen-2-yl]pyridine-3-carboxylate (PubChem CID 18718074) has the molecular formula C23H15ClNO3S- and a molecular weight of 420.90 g/mol. Its IUPAC name is 5-[3-(5-chloro-2-phenylmethoxyphenyl)thiophen-2-yl]pyridine-3-carboxylate.
| Compound Name | 5-[3-(5-chloro-2-phenylmethoxyphenyl)thiophen-2-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 18718074 |
| Molecular Formula | C23H15ClNO3S- |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 5-[3-(5-chloro-2-phenylmethoxyphenyl)thiophen-2-yl]pyridine-3-carboxylate |
| SMILES | O=C([O-])c1cncc(-c2sccc2-c2cc(Cl)ccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H16ClNO3S/c24-18-6-7-21(28-14-15-4-2-1-3-5-15)20(11-18)19-8-9-29-22(19)16-10-17(23(26)27)13-25-12-16/h1-13H,14H2,(H,26,27)/p-1 |
| InChIKey | ONFDZOUFCUXZFV-UHFFFAOYSA-M |
| XLogP | 5.07 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |