C24H17NaO3S — CID 23679676
sodium 4-[3-(2-phenylmethoxyphenyl)thiophen-2-yl]benzoate (PubChem CID 23679676) has the molecular formula C24H17NaO3S and a molecular weight of 408.45 g/mol. Its IUPAC name is sodium 4-[3-(2-phenylmethoxyphenyl)thiophen-2-yl]benzoate.
| Compound Name | sodium 4-[3-(2-phenylmethoxyphenyl)thiophen-2-yl]benzoate |
|---|---|
| PubChem CID | 23679676 |
| Molecular Formula | C24H17NaO3S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | sodium 4-[3-(2-phenylmethoxyphenyl)thiophen-2-yl]benzoate |
| SMILES | O=C([O-])c1ccc(-c2sccc2-c2ccccc2OCc2ccccc2)cc1.[Na+] |
| InChI | InChI=1S/C24H18O3S.Na/c25-24(26)19-12-10-18(11-13-19)23-21(14-15-28-23)20-8-4-5-9-22(20)27-16-17-6-2-1-3-7-17;/h1-15H,16H2,(H,25,26);/q;+1/p-1 |
| InChIKey | DEFCUMMBNOVKKC-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |