C24H19NO3S — CID 58127521
4-[[4-(2-phenylmethoxyphenyl)-1,3-thiazol-2-yl]methyl]benzoic acid (PubChem CID 58127521) has the molecular formula C24H19NO3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 4-[[4-(2-phenylmethoxyphenyl)-1,3-thiazol-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-(2-phenylmethoxyphenyl)-1,3-thiazol-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 58127521 |
| Molecular Formula | C24H19NO3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4-[[4-(2-phenylmethoxyphenyl)-1,3-thiazol-2-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cc2nc(-c3ccccc3OCc3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C24H19NO3S/c26-24(27)19-12-10-17(11-13-19)14-23-25-21(16-29-23)20-8-4-5-9-22(20)28-15-18-6-2-1-3-7-18/h1-13,16H,14-15H2,(H,26,27) |
| InChIKey | DRCWJRWRPFEMPR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |