C26H23N3O3S — CID 38858056
2-(2-benzyl-1,3-thiazol-4-yl)-N'-[2-(2-phenylphenoxy)acetyl]acetohydrazide (PubChem CID 38858056) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-thiazol-4-yl)-N'-[2-(2-phenylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N'-[2-(2-phenylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 38858056 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N'-[2-(2-phenylphenoxy)acetyl]acetohydrazide |
| SMILES | O=C(COc1ccccc1-c1ccccc1)NNC(=O)Cc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C26H23N3O3S/c30-24(16-21-18-33-26(27-21)15-19-9-3-1-4-10-19)28-29-25(31)17-32-23-14-8-7-13-22(23)20-11-5-2-6-12-20/h1-14,18H,15-17H2,(H,28,30)(H,29,31) |
| InChIKey | QMRAHMSHNBSMGV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|