C20H18N2O3S — CID 7978348
N'-[2-(2-phenylphenoxy)acetyl]-2-thiophen-2-ylacetohydrazide (PubChem CID 7978348) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is N'-[2-(2-phenylphenoxy)acetyl]-2-thiophen-2-ylacetohydrazide.
| Compound Name | N'-[2-(2-phenylphenoxy)acetyl]-2-thiophen-2-ylacetohydrazide |
|---|---|
| PubChem CID | 7978348 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N'-[2-(2-phenylphenoxy)acetyl]-2-thiophen-2-ylacetohydrazide |
| SMILES | O=C(COc1ccccc1-c1ccccc1)NNC(=O)Cc1cccs1 |
| InChI | InChI=1S/C20H18N2O3S/c23-19(13-16-9-6-12-26-16)21-22-20(24)14-25-18-11-5-4-10-17(18)15-7-2-1-3-8-15/h1-12H,13-14H2,(H,21,23)(H,22,24) |
| InChIKey | ZTXRNKXEQIEDOB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|