C21H21N3O5S2 — CID 55913380
N-[1-oxo-1-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]propan-2-yl]thiophene-2-sulfonamide (PubChem CID 55913380) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[1-oxo-1-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]propan-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-oxo-1-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]propan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55913380 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-[1-oxo-1-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]propan-2-yl]thiophene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)NNC(=O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H21N3O5S2/c1-15(24-31(27,28)20-12-7-13-30-20)21(26)23-22-19(25)14-29-18-11-6-5-10-17(18)16-8-3-2-4-9-16/h2-13,15,24H,14H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | FCYDQWXBWLULCW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|