C17H12FNO2S — CID 176901735
2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]benzoic acid (PubChem CID 176901735) has the molecular formula C17H12FNO2S and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 176901735 |
| Molecular Formula | C17H12FNO2S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1csc(Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H12FNO2S/c18-12-7-5-11(6-8-12)9-16-19-15(10-22-16)13-3-1-2-4-14(13)17(20)21/h1-8,10H,9H2,(H,20,21) |
| InChIKey | IKXYWHYRCGMVDJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |