C16H12FNS — CID 47173323
2-[(4-fluorophenyl)methyl]-4-phenyl-1,3-thiazole (PubChem CID 47173323) has the molecular formula C16H12FNS and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-4-phenyl-1,3-thiazole.
| Compound Name | 2-[(4-fluorophenyl)methyl]-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 47173323 |
| Molecular Formula | C16H12FNS |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-4-phenyl-1,3-thiazole |
| SMILES | Fc1ccc(Cc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C16H12FNS/c17-14-8-6-12(7-9-14)10-16-18-15(11-19-16)13-4-2-1-3-5-13/h1-9,11H,10H2 |
| InChIKey | DRTVNWYPGYCAOV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |