C16H13NOS — CID 22054946
3-(2-benzyl-1,3-thiazol-4-yl)phenol (PubChem CID 22054946) has the molecular formula C16H13NOS and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-(2-benzyl-1,3-thiazol-4-yl)phenol.
| Compound Name | 3-(2-benzyl-1,3-thiazol-4-yl)phenol |
|---|---|
| PubChem CID | 22054946 |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-(2-benzyl-1,3-thiazol-4-yl)phenol |
| SMILES | Oc1cccc(-c2csc(Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C16H13NOS/c18-14-8-4-7-13(10-14)15-11-19-16(17-15)9-12-5-2-1-3-6-12/h1-8,10-11,18H,9H2 |
| InChIKey | YMOIRGPWBXAZMD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |