C16H11Cl2NOS — CID 22932379
4-(2-benzyl-1,3-thiazol-4-yl)-2,6-dichlorophenol (PubChem CID 22932379) has the molecular formula C16H11Cl2NOS and a molecular weight of 336.24 g/mol. Its IUPAC name is 4-(2-benzyl-1,3-thiazol-4-yl)-2,6-dichlorophenol.
| Compound Name | 4-(2-benzyl-1,3-thiazol-4-yl)-2,6-dichlorophenol |
|---|---|
| PubChem CID | 22932379 |
| Molecular Formula | C16H11Cl2NOS |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 4-(2-benzyl-1,3-thiazol-4-yl)-2,6-dichlorophenol |
| SMILES | Oc1c(Cl)cc(-c2csc(Cc3ccccc3)n2)cc1Cl |
| InChI | InChI=1S/C16H11Cl2NOS/c17-12-7-11(8-13(18)16(12)20)14-9-21-15(19-14)6-10-4-2-1-3-5-10/h1-5,7-9,20H,6H2 |
| InChIKey | NSULKLOAUJNJPC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |