C16H10BrCl2NS — CID 79831454
4-(3-bromophenyl)-2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole (PubChem CID 79831454) has the molecular formula C16H10BrCl2NS and a molecular weight of 399.14 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole.
| Compound Name | 4-(3-bromophenyl)-2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79831454 |
| Molecular Formula | C16H10BrCl2NS |
| Molecular Weight | 399.14 g/mol |
| Exact Mass | 396.91 |
| IUPAC Name | 4-(3-bromophenyl)-2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole |
| SMILES | Clc1ccc(Cc2nc(-c3cccc(Br)c3)cs2)cc1Cl |
| InChI | InChI=1S/C16H10BrCl2NS/c17-12-3-1-2-11(8-12)15-9-21-16(20-15)7-10-4-5-13(18)14(19)6-10/h1-6,8-9H,7H2 |
| InChIKey | KERZJIQGVDXGLN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.14 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |