C16H9BrCl2N2OS — CID 19195083
N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide (PubChem CID 19195083) has the molecular formula C16H9BrCl2N2OS and a molecular weight of 428.14 g/mol. Its IUPAC name is N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide.
| Compound Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 19195083 |
| Molecular Formula | C16H9BrCl2N2OS |
| Molecular Weight | 428.14 g/mol |
| Exact Mass | 425.90 |
| IUPAC Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide |
| SMILES | O=C(Nc1nc(-c2cccc(Br)c2)cs1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H9BrCl2N2OS/c17-11-3-1-2-9(6-11)14-8-23-16(20-14)21-15(22)10-4-5-12(18)13(19)7-10/h1-8H,(H,20,21,22) |
| InChIKey | DLVSGSRIKIRCOO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.14 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |