C17H16N2S — CID 63152013
[4-(2-benzyl-1,3-thiazol-4-yl)phenyl]methanamine (PubChem CID 63152013) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is [4-(2-benzyl-1,3-thiazol-4-yl)phenyl]methanamine.
| Compound Name | [4-(2-benzyl-1,3-thiazol-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 63152013 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | [4-(2-benzyl-1,3-thiazol-4-yl)phenyl]methanamine |
| SMILES | NCc1ccc(-c2csc(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H16N2S/c18-11-14-6-8-15(9-7-14)16-12-20-17(19-16)10-13-4-2-1-3-5-13/h1-9,12H,10-11,18H2 |
| InChIKey | JFBSJKJFZPHZTP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |