C16H13NO2S — CID 53391458
4-[[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]methyl]phenol (PubChem CID 53391458) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-[[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]methyl]phenol.
| Compound Name | 4-[[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 53391458 |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-[[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]methyl]phenol |
| SMILES | Oc1ccc(Cc2nc(-c3ccc(O)cc3)cs2)cc1 |
| InChI | InChI=1S/C16H13NO2S/c18-13-5-1-11(2-6-13)9-16-17-15(10-20-16)12-3-7-14(19)8-4-12/h1-8,10,18-19H,9H2 |
| InChIKey | AVLNRVQTGOYDNP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |