C17H15N3O3S — CID 174450675
4-[2-[[(4-nitrophenyl)methylamino]methyl]-1,3-thiazol-4-yl]phenol (PubChem CID 174450675) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 4-[2-[[(4-nitrophenyl)methylamino]methyl]-1,3-thiazol-4-yl]phenol.
| Compound Name | 4-[2-[[(4-nitrophenyl)methylamino]methyl]-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 174450675 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 4-[2-[[(4-nitrophenyl)methylamino]methyl]-1,3-thiazol-4-yl]phenol |
| SMILES | O=[N+]([O-])c1ccc(CNCc2nc(-c3ccc(O)cc3)cs2)cc1 |
| InChI | InChI=1S/C17H15N3O3S/c21-15-7-3-13(4-8-15)16-11-24-17(19-16)10-18-9-12-1-5-14(6-2-12)20(22)23/h1-8,11,18,21H,9-10H2 |
| InChIKey | DXQBMCQUEXXEPI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|