C11H10N2O3S — CID 146469372
[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]methylcarbamic acid (PubChem CID 146469372) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is [4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]methylcarbamic acid.
| Compound Name | [4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 146469372 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | [4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]methylcarbamic acid |
| SMILES | O=C(O)NCc1nc(-c2ccc(O)cc2)cs1 |
| InChI | InChI=1S/C11H10N2O3S/c14-8-3-1-7(2-4-8)9-6-17-10(13-9)5-12-11(15)16/h1-4,6,12,14H,5H2,(H,15,16) |
| InChIKey | PVGYWLVVPDBWBE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |