C18H23N3O2S — CID 171617303
N'-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]heptanediamide (PubChem CID 171617303) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is N'-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]heptanediamide.
| Compound Name | N'-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]heptanediamide |
|---|---|
| PubChem CID | 171617303 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N'-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]heptanediamide |
| SMILES | Cc1ccc(-c2csc(CNC(=O)CCCCCC(N)=O)n2)cc1 |
| InChI | InChI=1S/C18H23N3O2S/c1-13-7-9-14(10-8-13)15-12-24-18(21-15)11-20-17(23)6-4-2-3-5-16(19)22/h7-10,12H,2-6,11H2,1H3,(H2,19,22)(H,20,23) |
| InChIKey | XSFMBZLGDZNPDR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|