C10H16N2OS — CID 110739073
N-[(4-methyl-1,3-thiazol-2-yl)methyl]pentanamide (PubChem CID 110739073) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is N-[(4-methyl-1,3-thiazol-2-yl)methyl]pentanamide.
| Compound Name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 110739073 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]pentanamide |
| SMILES | CCCCC(=O)NCc1nc(C)cs1 |
| InChI | InChI=1S/C10H16N2OS/c1-3-4-5-9(13)11-6-10-12-8(2)7-14-10/h7H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | LGFVFIMJPBZMBS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |