C7H10N2O2S — CID 110739075
methyl N-[(4-methyl-1,3-thiazol-2-yl)methyl]carbamate (PubChem CID 110739075) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is methyl N-[(4-methyl-1,3-thiazol-2-yl)methyl]carbamate.
| Compound Name | methyl N-[(4-methyl-1,3-thiazol-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 110739075 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | methyl N-[(4-methyl-1,3-thiazol-2-yl)methyl]carbamate |
| SMILES | COC(=O)NCc1nc(C)cs1 |
| InChI | InChI=1S/C7H10N2O2S/c1-5-4-12-6(9-5)3-8-7(10)11-2/h4H,3H2,1-2H3,(H,8,10) |
| InChIKey | BENIEYIDJUPAHW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |