C9H13BrN2OS — CID 62856861
2-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butanamide (PubChem CID 62856861) has the molecular formula C9H13BrN2OS and a molecular weight of 277.19 g/mol. Its IUPAC name is 2-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butanamide.
| Compound Name | 2-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 62856861 |
| Molecular Formula | C9H13BrN2OS |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 2-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butanamide |
| SMILES | CCC(Br)C(=O)NCc1nc(C)cs1 |
| InChI | InChI=1S/C9H13BrN2OS/c1-3-7(10)9(13)11-4-8-12-6(2)5-14-8/h5,7H,3-4H2,1-2H3,(H,11,13) |
| InChIKey | SJEFQIPAEAPAPM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|