C10H14N2O3S — CID 110465416
ethyl 3-[(4-methyl-1,3-thiazol-2-yl)methylamino]-3-oxopropanoate (PubChem CID 110465416) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is ethyl 3-[(4-methyl-1,3-thiazol-2-yl)methylamino]-3-oxopropanoate.
| Compound Name | ethyl 3-[(4-methyl-1,3-thiazol-2-yl)methylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 110465416 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | ethyl 3-[(4-methyl-1,3-thiazol-2-yl)methylamino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NCc1nc(C)cs1 |
| InChI | InChI=1S/C10H14N2O3S/c1-3-15-10(14)4-8(13)11-5-9-12-7(2)6-16-9/h6H,3-5H2,1-2H3,(H,11,13) |
| InChIKey | QJESMTPVPWGBFE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|